C12H13ClF3N3O4 — CID 171399953
(1S,2R,3R,4R,5S)-4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1-methyl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 171399953) has the molecular formula C12H13ClF3N3O4 and a molecular weight of 355.70 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1-methyl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1-methyl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 171399953 |
| Molecular Formula | C12H13ClF3N3O4 |
| Molecular Weight | 355.70 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | (1S,2R,3R,4R,5S)-4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1-methyl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | C[C@@]12CO[C@@H](O1)[C@H](Nc1ncc(C(F)(F)F)c(Cl)n1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C12H13ClF3N3O4/c1-11-3-22-9(23-11)5(6(20)7(11)21)18-10-17-2-4(8(13)19-10)12(14,15)16/h2,5-7,9,20-21H,3H2,1H3,(H,17,18,19)/t5-,6-,7-,9+,11+/m1/s1 |
| InChIKey | PPLDRNOGXIVKIE-VBGZFMGZSA-N |
| XLogP | 0.80 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.70 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |