C24H24F3N5O4 — CID 171400081
N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-6-(4-methylphenyl)pyridine-3-carboxamide (PubChem CID 171400081) has the molecular formula C24H24F3N5O4 and a molecular weight of 503.48 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-6-(4-methylphenyl)pyridine-3-carboxamide.
| Compound Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-6-(4-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171400081 |
| Molecular Formula | C24H24F3N5O4 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-6-(4-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC[C@H]3OC[C@H](Nc4cncc(C(F)(F)F)n4)[C@@H](O)[C@H]3O)cn2)cc1 |
| InChI | InChI=1S/C24H24F3N5O4/c1-13-2-4-14(5-3-13)16-7-6-15(8-29-16)23(35)30-9-18-22(34)21(33)17(12-36-18)31-20-11-28-10-19(32-20)24(25,26)27/h2-8,10-11,17-18,21-22,33-34H,9,12H2,1H3,(H,30,35)(H,31,32)/t17-,18+,21+,22-/m0/s1 |
| InChIKey | HCAIDHKWFBYVNF-KKXYHZGYSA-N |
| XLogP | 2.20 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |