C13H18F3N3O5 — CID 171400104
(2R,3R,4R,5S)-2-(2-hydroxyethoxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171400104) has the molecular formula C13H18F3N3O5 and a molecular weight of 353.30 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(2-hydroxyethoxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-(2-hydroxyethoxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171400104 |
| Molecular Formula | C13H18F3N3O5 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2R,3R,4R,5S)-2-(2-hydroxyethoxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | OCCOC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18F3N3O5/c14-13(15,16)9-3-17-4-10(19-9)18-7-5-24-8(6-23-2-1-20)12(22)11(7)21/h3-4,7-8,11-12,20-22H,1-2,5-6H2,(H,18,19)/t7-,8+,11+,12-/m0/s1 |
| InChIKey | OPXPHKPZYXBGRP-MDSNHJATSA-N |
| XLogP | -0.59 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|