C13H22N2O — CID 171400493
N-[(E)-4-methylpent-3-en-2-ylideneamino]cyclohexanecarboxamide (PubChem CID 171400493) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-[(E)-4-methylpent-3-en-2-ylideneamino]cyclohexanecarboxamide.
| Compound Name | N-[(E)-4-methylpent-3-en-2-ylideneamino]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 171400493 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-[(E)-4-methylpent-3-en-2-ylideneamino]cyclohexanecarboxamide |
| SMILES | CC(C)=C/C(C)=N/NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H22N2O/c1-10(2)9-11(3)14-15-13(16)12-7-5-4-6-8-12/h9,12H,4-8H2,1-3H3,(H,15,16)/b14-11+ |
| InChIKey | CSWUDQIGENPYDG-SDNWHVSQSA-N |
| XLogP | 3.03 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|