C24H19FN6O3S — CID 171401082
[(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-[5-[4-fluoro-2-(1-isocyanocyclopropyl)phenyl]-2-pyridinyl]ethyl] carbamate (PubChem CID 171401082) has the molecular formula C24H19FN6O3S and a molecular weight of 490.52 g/mol. Its IUPAC name is [(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-[5-[4-fluoro-2-(1-isocyanocyclopropyl)phenyl]-2-pyridinyl]ethyl] carbamate.
| Compound Name | [(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-[5-[4-fluoro-2-(1-isocyanocyclopropyl)phenyl]-2-pyridinyl]ethyl] carbamate |
|---|---|
| PubChem CID | 171401082 |
| Molecular Formula | C24H19FN6O3S |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-[5-[4-fluoro-2-(1-isocyanocyclopropyl)phenyl]-2-pyridinyl]ethyl] carbamate |
| SMILES | [C-]#[N+]C1(c2cc(F)ccc2-c2ccc([C@H](COC(N)=O)NC(=O)Nc3csc(C#C)n3)nc2)CC1 |
| InChI | InChI=1S/C24H19FN6O3S/c1-3-21-30-20(13-35-21)31-23(33)29-19(12-34-22(26)32)18-7-4-14(11-28-18)16-6-5-15(25)10-17(16)24(27-2)8-9-24/h1,4-7,10-11,13,19H,8-9,12H2,(H2,26,32)(H2,29,31,33)/t19-/m0/s1 |
| InChIKey | KOKVFKBWBQAXSD-IBGZPJMESA-N |
| XLogP | 4.19 |
| TPSA | 123.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|