C32H40N2O2S2 — CID 171401322
4-[6-[1-phenyl-1-[3-(3-sulfanylbutyl)-2,4-dihydro-1,3-benzoxazin-6-yl]ethyl]-2,4-dihydro-1,3-benzoxazin-3-yl]butane-2-thiol (PubChem CID 171401322) has the molecular formula C32H40N2O2S2 and a molecular weight of 548.82 g/mol. Its IUPAC name is 4-[6-[1-phenyl-1-[3-(3-sulfanylbutyl)-2,4-dihydro-1,3-benzoxazin-6-yl]ethyl]-2,4-dihydro-1,3-benzoxazin-3-yl]butane-2-thiol.
| Compound Name | 4-[6-[1-phenyl-1-[3-(3-sulfanylbutyl)-2,4-dihydro-1,3-benzoxazin-6-yl]ethyl]-2,4-dihydro-1,3-benzoxazin-3-yl]butane-2-thiol |
|---|---|
| PubChem CID | 171401322 |
| Molecular Formula | C32H40N2O2S2 |
| Molecular Weight | 548.82 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 4-[6-[1-phenyl-1-[3-(3-sulfanylbutyl)-2,4-dihydro-1,3-benzoxazin-6-yl]ethyl]-2,4-dihydro-1,3-benzoxazin-3-yl]butane-2-thiol |
| SMILES | CC(S)CCN1COc2ccc(C(C)(c3ccccc3)c3ccc4c(c3)CN(CCC(C)S)CO4)cc2C1 |
| InChI | InChI=1S/C32H40N2O2S2/c1-23(37)13-15-33-19-25-17-28(9-11-30(25)35-21-33)32(3,27-7-5-4-6-8-27)29-10-12-31-26(18-29)20-34(22-36-31)16-14-24(2)38/h4-12,17-18,23-24,37-38H,13-16,19-22H2,1-3H3 |
| InChIKey | VPJGNMFYGCBXGJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 24.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.82 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|