C33H57O12P — CID 171402334
bis(3-tert-butyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-yl) methyl phosphate (PubChem CID 171402334) has the molecular formula C33H57O12P and a molecular weight of 676.78 g/mol. Its IUPAC name is bis(3-tert-butyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-yl) methyl phosphate.
| Compound Name | bis(3-tert-butyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-yl) methyl phosphate |
|---|---|
| PubChem CID | 171402334 |
| Molecular Formula | C33H57O12P |
| Molecular Weight | 676.78 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | bis(3-tert-butyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-yl) methyl phosphate |
| SMILES | COP(=O)(OC1CCC2(CC1)OOC1(CCC(C(C)(C)C)CC1)OO2)OC1CCC2(CC1)OOC1(CCC(C(C)(C)C)CC1)OO2 |
| InChI | InChI=1S/C33H57O12P/c1-28(2,3)24-8-16-30(17-9-24)38-42-32(43-39-30)20-12-26(13-21-32)36-46(34,35-7)37-27-14-22-33(23-15-27)44-40-31(41-45-33)18-10-25(11-19-31)29(4,5)6/h24-27H,8-23H2,1-7H3 |
| InChIKey | PWOSMPVBQQNQCW-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 118.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.78 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|