C14H9BO3 — CID 171405013
15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-2-ylboronic acid (PubChem CID 171405013) has the molecular formula C14H9BO3 and a molecular weight of 236.04 g/mol. Its IUPAC name is 15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-2-ylboronic acid.
| Compound Name | 15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-2-ylboronic acid |
|---|---|
| PubChem CID | 171405013 |
| Molecular Formula | C14H9BO3 |
| Molecular Weight | 236.04 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-2-ylboronic acid |
| SMILES | OB(O)c1ccc2ccc3cccc4oc1c2c34 |
| InChI | InChI=1S/C14H9BO3/c16-15(17)10-7-6-9-5-4-8-2-1-3-11-12(8)13(9)14(10)18-11/h1-7,16-17H |
| InChIKey | CVTJLPFVYJHWJI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.04 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|