C58H55N3 — CID 171405020
5-[2-[3,5-bis[2-methyl-2-(6-phenyl-3-pyridinyl)propyl]phenyl]-1,1,2,2-tetradeuterioethyl]-4-(2,3-dihydro-1H-inden-5-yl)-2-phenylpyridine (PubChem CID 171405020) has the molecular formula C58H55N3 and a molecular weight of 798.12 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-methyl-2-(6-phenyl-3-pyridinyl)propyl]phenyl]-1,1,2,2-tetradeuterioethyl]-4-(2,3-dihydro-1H-inden-5-yl)-2-phenylpyridine.
| Compound Name | 5-[2-[3,5-bis[2-methyl-2-(6-phenyl-3-pyridinyl)propyl]phenyl]-1,1,2,2-tetradeuterioethyl]-4-(2,3-dihydro-1H-inden-5-yl)-2-phenylpyridine |
|---|---|
| PubChem CID | 171405020 |
| Molecular Formula | C58H55N3 |
| Molecular Weight | 798.12 g/mol |
| Exact Mass | 797.46 |
| IUPAC Name | 5-[2-[3,5-bis[2-methyl-2-(6-phenyl-3-pyridinyl)propyl]phenyl]-1,1,2,2-tetradeuterioethyl]-4-(2,3-dihydro-1H-inden-5-yl)-2-phenylpyridine |
| SMILES | [2H]C([2H])(c1cc(CC(C)(C)c2ccc(-c3ccccc3)nc2)cc(CC(C)(C)c2ccc(-c3ccccc3)nc2)c1)C([2H])([2H])c1cnc(-c2ccccc2)cc1-c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C58H55N3/c1-57(2,51-27-29-54(60-39-51)45-15-8-5-9-16-45)36-42-31-41(32-43(33-42)37-58(3,4)52-28-30-55(61-40-52)46-17-10-6-11-18-46)23-24-50-38-59-56(47-19-12-7-13-20-47)35-53(50)49-26-25-44-21-14-22-48(44)34-49/h5-13,15-20,25-35,38-40H,14,21-24,36-37H2,1-4H3/i23D2,24D2 |
| InChIKey | ARKMRDNHDCWCLR-VBUDNUALSA-N |
| XLogP | 13.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.12 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |