C34H37N3O5 — CID 171405616
5-[[4-(9,9-dimethylacridin-10-yl)-2,5-dipropoxyphenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 171405616) has the molecular formula C34H37N3O5 and a molecular weight of 567.69 g/mol. Its IUPAC name is 5-[[4-(9,9-dimethylacridin-10-yl)-2,5-dipropoxyphenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-(9,9-dimethylacridin-10-yl)-2,5-dipropoxyphenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 171405616 |
| Molecular Formula | C34H37N3O5 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 5-[[4-(9,9-dimethylacridin-10-yl)-2,5-dipropoxyphenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1cc(N2c3ccccc3C(C)(C)c3ccccc32)c(OCCC)cc1C=C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C34H37N3O5/c1-7-17-41-29-21-28(37-26-15-11-9-13-24(26)34(3,4)25-14-10-12-16-27(25)37)30(42-18-8-2)20-22(29)19-23-31(38)35(5)33(40)36(6)32(23)39/h9-16,19-21H,7-8,17-18H2,1-6H3 |
| InChIKey | FDUSQTWEHLQDDC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|