C17H18N6O — CID 171405873
6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1(13),3,5,7-tetraene (PubChem CID 171405873) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1(13),3,5,7-tetraene.
| Compound Name | 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1(13),3,5,7-tetraene |
|---|---|
| PubChem CID | 171405873 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-2,3,5,7-tetrazatricyclo[6.4.1.04,13]trideca-1(13),3,5,7-tetraene |
| SMILES | COc1ncnc(C2CC2)c1-c1nc2c3c([nH]nc3n1)CCCC2 |
| InChI | InChI=1S/C17H18N6O/c1-24-17-13(14(9-6-7-9)18-8-19-17)15-20-10-4-2-3-5-11-12(10)16(21-15)23-22-11/h8-9H,2-7H2,1H3,(H,20,21,22,23) |
| InChIKey | MOGHFVBJCCDIKS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |