C28H22F7N5O5 — CID 171406019
N-[(2S)-2-[(3R)-3-azido-7-(4-fluorophenyl)-3-(trifluoromethyl)-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-cyclopropyloxy-3-methoxybenzamide (PubChem CID 171406019) has the molecular formula C28H22F7N5O5 and a molecular weight of 641.50 g/mol. Its IUPAC name is N-[(2S)-2-[(3R)-3-azido-7-(4-fluorophenyl)-3-(trifluoromethyl)-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-cyclopropyloxy-3-methoxybenzamide.
| Compound Name | N-[(2S)-2-[(3R)-3-azido-7-(4-fluorophenyl)-3-(trifluoromethyl)-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-cyclopropyloxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 171406019 |
| Molecular Formula | C28H22F7N5O5 |
| Molecular Weight | 641.50 g/mol |
| Exact Mass | 641.15 |
| IUPAC Name | N-[(2S)-2-[(3R)-3-azido-7-(4-fluorophenyl)-3-(trifluoromethyl)-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-4-cyclopropyloxy-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC[C@](O)(c2cc3c(c(-c4ccc(F)cc4)n2)OC[C@@]3(N=[N+]=[N-])C(F)(F)F)C(F)(F)F)ccc1OC1CC1 |
| InChI | InChI=1S/C28H22F7N5O5/c1-43-20-10-15(4-9-19(20)45-17-7-8-17)24(41)37-12-26(42,28(33,34)35)21-11-18-23(22(38-21)14-2-5-16(29)6-3-14)44-13-25(18,39-40-36)27(30,31)32/h2-6,9-11,17,42H,7-8,12-13H2,1H3,(H,37,41)/t25-,26-/m0/s1 |
| InChIKey | QQYUKKDZQVTLBF-UIOOFZCWSA-N |
| XLogP | 6.08 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|