C9H19BrN2O — CID 171406266
2-(1,2,2,3-tetramethylimidazol-1-ium-1-yl)ethanol bromide (PubChem CID 171406266) has the molecular formula C9H19BrN2O and a molecular weight of 251.17 g/mol. Its IUPAC name is 2-(1,2,2,3-tetramethylimidazol-1-ium-1-yl)ethanol bromide.
| Compound Name | 2-(1,2,2,3-tetramethylimidazol-1-ium-1-yl)ethanol bromide |
|---|---|
| PubChem CID | 171406266 |
| Molecular Formula | C9H19BrN2O |
| Molecular Weight | 251.17 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-(1,2,2,3-tetramethylimidazol-1-ium-1-yl)ethanol bromide |
| SMILES | CN1C=C[N+](C)(CCO)C1(C)C.[Br-] |
| InChI | InChI=1S/C9H19N2O.BrH/c1-9(2)10(3)5-6-11(9,4)7-8-12;/h5-6,12H,7-8H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | KJZYAEJRPVTSTJ-UHFFFAOYSA-M |
| XLogP | -2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.17 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|