C35H33FN3O+ — CID 171407192
9-[6-(1,3-dimethylimidazol-1-ium-2-yl)-9-(2,2-dimethylpropyl)-3-fluoro-7-methyldibenzofuran-4-yl]carbazole (PubChem CID 171407192) has the molecular formula C35H33FN3O+ and a molecular weight of 530.67 g/mol. Its IUPAC name is 9-[6-(1,3-dimethylimidazol-1-ium-2-yl)-9-(2,2-dimethylpropyl)-3-fluoro-7-methyldibenzofuran-4-yl]carbazole.
| Compound Name | 9-[6-(1,3-dimethylimidazol-1-ium-2-yl)-9-(2,2-dimethylpropyl)-3-fluoro-7-methyldibenzofuran-4-yl]carbazole |
|---|---|
| PubChem CID | 171407192 |
| Molecular Formula | C35H33FN3O+ |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 9-[6-(1,3-dimethylimidazol-1-ium-2-yl)-9-(2,2-dimethylpropyl)-3-fluoro-7-methyldibenzofuran-4-yl]carbazole |
| SMILES | Cc1cc(CC(C)(C)C)c2c(oc3c(-n4c5ccccc5c5ccccc54)c(F)ccc32)c1-c1n(C)cc[n+]1C |
| InChI | InChI=1S/C35H33FN3O/c1-21-19-22(20-35(2,3)4)30-25-15-16-26(36)31(32(25)40-33(30)29(21)34-37(5)17-18-38(34)6)39-27-13-9-7-11-23(27)24-12-8-10-14-28(24)39/h7-19H,20H2,1-6H3/q+1 |
| InChIKey | CMWXABCNDJJJRQ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 26.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|