About (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide
(E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide (PubChem CID 171407278) has the molecular formula C18H24N2O3S
and a molecular weight of 348.47 g/mol. Its IUPAC name is (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide.
Molecular Properties
| Compound Name | (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide |
| PubChem CID | 171407278 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide |
| SMILES | C#Cc1nc(/C=C/CCCCCC(=O)NOC2CCCCO2)cs1 |
| InChI | InChI=1S/C18H24N2O3S/c1-2-17-19-15(14-24-17)10-6-4-3-5-7-11-16(21)20-23-18-12-8-9-13-22-18/h1,6,10,14,18H,3-5,7-9,11-13H2,(H,20,21)/b10-6+ |
| InChIKey | MBJQFNRHYCIMDG-UXBLZVDNSA-N |
| XLogP | 3.66 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide?
The IUPAC name of (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide (CID 171407278) is (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide.
What is the SMILES notation for (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide?
The canonical SMILES for (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide is C#Cc1nc(/C=C/CCCCCC(=O)NOC2CCCCO2)cs1.
What is the InChIKey of (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide?
The InChIKey is MBJQFNRHYCIMDG-UXBLZVDNSA-N. The full InChI is InChI=1S/C18H24N2O3S/c1-2-17-19-15(14-24-17)10-6-4-3-5-7-11-16(21)20-23-18-12-8-9-13-22-18/h1,6,10,14,18H,3-5,7-9,11-13H2,(H,20,21)/b10-6+.
What are the key properties of (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide?
(E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide has a molecular weight of 348.47 g/mol, XLogP of 3.66, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-(2-ethynyl-1,3-thiazol-4-yl)-N-(oxan-2-yloxy)oct-7-enamide is sourced from PubChem (CID 171407278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).