C24H21F3N4OS — CID 171407411
4-(3-aminopyrrolidin-1-yl)-2,6-difluoro-N-[4-[(2S)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]benzamide (PubChem CID 171407411) has the molecular formula C24H21F3N4OS and a molecular weight of 470.52 g/mol. Its IUPAC name is 4-(3-aminopyrrolidin-1-yl)-2,6-difluoro-N-[4-[(2S)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(3-aminopyrrolidin-1-yl)-2,6-difluoro-N-[4-[(2S)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 171407411 |
| Molecular Formula | C24H21F3N4OS |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 4-(3-aminopyrrolidin-1-yl)-2,6-difluoro-N-[4-[(2S)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]benzamide |
| SMILES | C#C[C@@](C)(c1ccc(F)cc1)c1csc(NC(=O)c2c(F)cc(N3CCC(N)C3)cc2F)n1 |
| InChI | InChI=1S/C24H21F3N4OS/c1-3-24(2,14-4-6-15(25)7-5-14)20-13-33-23(29-20)30-22(32)21-18(26)10-17(11-19(21)27)31-9-8-16(28)12-31/h1,4-7,10-11,13,16H,8-9,12,28H2,2H3,(H,29,30,32)/t16?,24-/m0/s1 |
| InChIKey | AIWBHAOWGAJELF-ODOSRFNGSA-N |
| XLogP | 4.29 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|