C25H25FN4O2S — CID 171407425
N-[4-[(2R)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-4-[3-(hydroxymethyl)piperazin-1-yl]benzamide (PubChem CID 171407425) has the molecular formula C25H25FN4O2S and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[4-[(2R)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-4-[3-(hydroxymethyl)piperazin-1-yl]benzamide.
| Compound Name | N-[4-[(2R)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-4-[3-(hydroxymethyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 171407425 |
| Molecular Formula | C25H25FN4O2S |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-[4-[(2R)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-4-[3-(hydroxymethyl)piperazin-1-yl]benzamide |
| SMILES | C#C[C@](C)(c1ccc(F)cc1)c1csc(NC(=O)c2ccc(N3CCNC(CO)C3)cc2)n1 |
| InChI | InChI=1S/C25H25FN4O2S/c1-3-25(2,18-6-8-19(26)9-7-18)22-16-33-24(28-22)29-23(32)17-4-10-21(11-5-17)30-13-12-27-20(14-30)15-31/h1,4-11,16,20,27,31H,12-15H2,2H3,(H,28,29,32)/t20?,25-/m1/s1 |
| InChIKey | QKRPMQVZBSLIPL-GBAXHLBXSA-N |
| XLogP | 3.24 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|