C24H21F3N4OS — CID 171407433
2,6-difluoro-N-[4-[(2S)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-4-piperazin-1-ylbenzamide (PubChem CID 171407433) has the molecular formula C24H21F3N4OS and a molecular weight of 470.52 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-[(2S)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-4-piperazin-1-ylbenzamide.
| Compound Name | 2,6-difluoro-N-[4-[(2S)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 171407433 |
| Molecular Formula | C24H21F3N4OS |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2,6-difluoro-N-[4-[(2S)-2-(4-fluorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-4-piperazin-1-ylbenzamide |
| SMILES | C#C[C@@](C)(c1ccc(F)cc1)c1csc(NC(=O)c2c(F)cc(N3CCNCC3)cc2F)n1 |
| InChI | InChI=1S/C24H21F3N4OS/c1-3-24(2,15-4-6-16(25)7-5-15)20-14-33-23(29-20)30-22(32)21-18(26)12-17(13-19(21)27)31-10-8-28-9-11-31/h1,4-7,12-14,28H,8-11H2,2H3,(H,29,30,32)/t24-/m0/s1 |
| InChIKey | GCHKYKTYBGOZEG-DEOSSOPVSA-N |
| XLogP | 4.16 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|