C25H23ClF2N4O2S — CID 171407435
N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-4-[2-(hydroxymethyl)piperazin-1-yl]benzamide (PubChem CID 171407435) has the molecular formula C25H23ClF2N4O2S and a molecular weight of 517.00 g/mol. Its IUPAC name is N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-4-[2-(hydroxymethyl)piperazin-1-yl]benzamide.
| Compound Name | N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-4-[2-(hydroxymethyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 171407435 |
| Molecular Formula | C25H23ClF2N4O2S |
| Molecular Weight | 517.00 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-4-[2-(hydroxymethyl)piperazin-1-yl]benzamide |
| SMILES | C#CC(C)(c1ccc(Cl)cc1)c1csc(NC(=O)c2c(F)cc(N3CCNCC3CO)cc2F)n1 |
| InChI | InChI=1S/C25H23ClF2N4O2S/c1-3-25(2,15-4-6-16(26)7-5-15)21-14-35-24(30-21)31-23(34)22-19(27)10-17(11-20(22)28)32-9-8-29-12-18(32)13-33/h1,4-7,10-11,14,18,29,33H,8-9,12-13H2,2H3,(H,30,31,34) |
| InChIKey | OSVYIUSJBSNYHH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.00 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|