C24H20Cl2F2N4OS — CID 171407449
N-[5-chloro-4-[(2S)-2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-4-piperazin-1-ylbenzamide (PubChem CID 171407449) has the molecular formula C24H20Cl2F2N4OS and a molecular weight of 521.42 g/mol. Its IUPAC name is N-[5-chloro-4-[(2S)-2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-4-piperazin-1-ylbenzamide.
| Compound Name | N-[5-chloro-4-[(2S)-2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 171407449 |
| Molecular Formula | C24H20Cl2F2N4OS |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | N-[5-chloro-4-[(2S)-2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-4-piperazin-1-ylbenzamide |
| SMILES | C#C[C@@](C)(c1ccc(Cl)cc1)c1nc(NC(=O)c2c(F)cc(N3CCNCC3)cc2F)sc1Cl |
| InChI | InChI=1S/C24H20Cl2F2N4OS/c1-3-24(2,14-4-6-15(25)7-5-14)20-21(26)34-23(30-20)31-22(33)19-17(27)12-16(13-18(19)28)32-10-8-29-9-11-32/h1,4-7,12-13,29H,8-11H2,2H3,(H,30,31,33)/t24-/m0/s1 |
| InChIKey | FSVCKSNEGJPVJZ-DEOSSOPVSA-N |
| XLogP | 5.33 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|