About CID 171408447
CID 171408447 (PubChem CID 171408447) has the molecular formula C11H16N
and a molecular weight of 162.26 g/mol.
Molecular Properties
| Compound Name | CID 171408447 |
| PubChem CID | 171408447 |
| Molecular Formula | C11H16N |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | — |
| SMILES | C[C](C)c1ccc(C(C)C)nc1 |
| InChI | InChI=1S/C11H16N/c1-8(2)10-5-6-11(9(3)4)12-7-10/h5-7,9H,1-4H3 |
| InChIKey | RUJDMKNWBDYVSJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 171408447 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171408447?
The IUPAC name of CID 171408447 (CID 171408447) is not available.
What is the SMILES notation for CID 171408447?
The canonical SMILES for CID 171408447 is C[C](C)c1ccc(C(C)C)nc1.
What is the InChIKey of CID 171408447?
The InChIKey is RUJDMKNWBDYVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N/c1-8(2)10-5-6-11(9(3)4)12-7-10/h5-7,9H,1-4H3.
What are the key properties of CID 171408447?
CID 171408447 has a molecular weight of 162.26 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171408447 is sourced from PubChem (CID 171408447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).