C15H12BrClFN7O — CID 171409328
1-(4-bromo-2-chloro-5-fluorophenyl)-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 171409328) has the molecular formula C15H12BrClFN7O and a molecular weight of 440.66 g/mol. Its IUPAC name is 1-(4-bromo-2-chloro-5-fluorophenyl)-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-(4-bromo-2-chloro-5-fluorophenyl)-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 171409328 |
| Molecular Formula | C15H12BrClFN7O |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | 1-(4-bromo-2-chloro-5-fluorophenyl)-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1cc(F)c(Br)cc1Cl)c1ncnn1-c1ncccn1 |
| InChI | InChI=1S/C15H12BrClFN7O/c1-8(13-21-7-22-25(13)14-19-3-2-4-20-14)23-15(26)24-12-6-11(18)9(16)5-10(12)17/h2-8H,1H3,(H2,23,24,26)/t8-/m0/s1 |
| InChIKey | VUYLWQUSGVOTPP-QMMMGPOBSA-N |
| XLogP | 3.49 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|