C24H24Cl2F3N7O3 — CID 171409482
1-[2,4-dichloro-5-(trifluoromethyl)phenyl]-3-[(1S)-1-[2-[5-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-2-pyridinyl]-1,2,4-triazol-3-yl]ethyl]urea (PubChem CID 171409482) has the molecular formula C24H24Cl2F3N7O3 and a molecular weight of 586.40 g/mol. Its IUPAC name is 1-[2,4-dichloro-5-(trifluoromethyl)phenyl]-3-[(1S)-1-[2-[5-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-2-pyridinyl]-1,2,4-triazol-3-yl]ethyl]urea.
| Compound Name | 1-[2,4-dichloro-5-(trifluoromethyl)phenyl]-3-[(1S)-1-[2-[5-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-2-pyridinyl]-1,2,4-triazol-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 171409482 |
| Molecular Formula | C24H24Cl2F3N7O3 |
| Molecular Weight | 586.40 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | 1-[2,4-dichloro-5-(trifluoromethyl)phenyl]-3-[(1S)-1-[2-[5-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-2-pyridinyl]-1,2,4-triazol-3-yl]ethyl]urea |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(-n3ncnc3[C@H](C)NC(=O)Nc3cc(C(F)(F)F)c(Cl)cc3Cl)nc2)C[C@H](C)O1 |
| InChI | InChI=1S/C24H24Cl2F3N7O3/c1-12-9-35(10-13(2)39-12)22(37)15-4-5-20(30-8-15)36-21(31-11-32-36)14(3)33-23(38)34-19-6-16(24(27,28)29)17(25)7-18(19)26/h4-8,11-14H,9-10H2,1-3H3,(H2,33,34,38)/t12-,13+,14-/m0/s1 |
| InChIKey | GFIBDMPSVHRRJR-MJBXVCDLSA-N |
| XLogP | 5.12 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |