C26H24FN7O — CID 171409979
3-[6-[(1S,6R,7S)-7-ethyl-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-5,6-dihydropyrrolo[3,4-b]pyridin-7-one (PubChem CID 171409979) has the molecular formula C26H24FN7O and a molecular weight of 469.52 g/mol. Its IUPAC name is 3-[6-[(1S,6R,7S)-7-ethyl-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-5,6-dihydropyrrolo[3,4-b]pyridin-7-one.
| Compound Name | 3-[6-[(1S,6R,7S)-7-ethyl-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-5,6-dihydropyrrolo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 171409979 |
| Molecular Formula | C26H24FN7O |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-[6-[(1S,6R,7S)-7-ethyl-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-5,6-dihydropyrrolo[3,4-b]pyridin-7-one |
| SMILES | CC[C@]1(c2ccccc2F)[C@@H]2CCN(c3cnc4c(-c5cnc6c(c5)CNC6=O)[nH]nc4n3)C[C@@H]21 |
| InChI | InChI=1S/C26H24FN7O/c1-2-26(17-5-3-4-6-19(17)27)16-7-8-34(13-18(16)26)20-12-29-23-21(32-33-24(23)31-20)14-9-15-11-30-25(35)22(15)28-10-14/h3-6,9-10,12,16,18H,2,7-8,11,13H2,1H3,(H,30,35)(H,31,32,33)/t16-,18+,26-/m1/s1 |
| InChIKey | GBTXWYJUZGKZBE-NWJQHBQLSA-N |
| XLogP | 3.60 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |