C24H29FN6 — CID 171410140
6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-3-(4,4-dimethylpent-2-ynimidoyl)pyrazin-2-amine (PubChem CID 171410140) has the molecular formula C24H29FN6 and a molecular weight of 420.54 g/mol. Its IUPAC name is 6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-3-(4,4-dimethylpent-2-ynimidoyl)pyrazin-2-amine.
| Compound Name | 6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-3-(4,4-dimethylpent-2-ynimidoyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171410140 |
| Molecular Formula | C24H29FN6 |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-3-(4,4-dimethylpent-2-ynimidoyl)pyrazin-2-amine |
| SMILES | [H]/N=C(\C#CC(C)(C)C)c1ncc(N2CC[C@@H]3[C@H](C2)[C@@]3(CN)c2ccccc2F)nc1N |
| InChI | InChI=1S/C24H29FN6/c1-23(2,3)10-8-19(27)21-22(28)30-20(12-29-21)31-11-9-15-17(13-31)24(15,14-26)16-6-4-5-7-18(16)25/h4-7,12,15,17,27H,9,11,13-14,26H2,1-3H3,(H2,28,30)/b27-19+/t15-,17+,24-/m1/s1 |
| InChIKey | LSFFICPPDONAPM-ZXPRBERWSA-N |
| XLogP | 2.97 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|