C26H17N3 — CID 171410905
18-isocyano-8-azaheptacyclo[18.2.2.18,15.02,7.06,10.09,14.019,25]pentacosa-2,4,6,9,11,13,15(25),16,18-nonaene-3-carbonitrile (PubChem CID 171410905) has the molecular formula C26H17N3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 18-isocyano-8-azaheptacyclo[18.2.2.18,15.02,7.06,10.09,14.019,25]pentacosa-2,4,6,9,11,13,15(25),16,18-nonaene-3-carbonitrile.
| Compound Name | 18-isocyano-8-azaheptacyclo[18.2.2.18,15.02,7.06,10.09,14.019,25]pentacosa-2,4,6,9,11,13,15(25),16,18-nonaene-3-carbonitrile |
|---|---|
| PubChem CID | 171410905 |
| Molecular Formula | C26H17N3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 18-isocyano-8-azaheptacyclo[18.2.2.18,15.02,7.06,10.09,14.019,25]pentacosa-2,4,6,9,11,13,15(25),16,18-nonaene-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c3cccc4c5ccc(C#N)c6c5n(c2c1C1CCC6CC1)c43 |
| InChI | InChI=1S/C26H17N3/c1-28-21-12-11-20-18-4-2-3-17-19-10-9-16(13-27)22-14-5-7-15(8-6-14)23(21)26(20)29(24(17)18)25(19)22/h2-4,9-12,14-15H,5-8H2 |
| InChIKey | ZUZYQOSQZKRJHX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 32.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|