C33H34F2N4O3 — CID 171414135
(1R,4S,6R)-3-(3,4-difluorophenyl)-4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(4-methoxy-1-bicyclo[2.2.2]octanyl)benzimidazol-2-yl]-3-azabicyclo[4.1.0]heptan-2-one (PubChem CID 171414135) has the molecular formula C33H34F2N4O3 and a molecular weight of 572.66 g/mol. Its IUPAC name is (1R,4S,6R)-3-(3,4-difluorophenyl)-4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(4-methoxy-1-bicyclo[2.2.2]octanyl)benzimidazol-2-yl]-3-azabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1R,4S,6R)-3-(3,4-difluorophenyl)-4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(4-methoxy-1-bicyclo[2.2.2]octanyl)benzimidazol-2-yl]-3-azabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 171414135 |
| Molecular Formula | C33H34F2N4O3 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | (1R,4S,6R)-3-(3,4-difluorophenyl)-4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(4-methoxy-1-bicyclo[2.2.2]octanyl)benzimidazol-2-yl]-3-azabicyclo[4.1.0]heptan-2-one |
| SMILES | COC12CCC(n3c([C@@H]4C[C@H]5C[C@H]5C(=O)N4c4ccc(F)c(F)c4)nc4cc(-c5c(C)noc5C)ccc43)(CC1)CC2 |
| InChI | InChI=1S/C33H34F2N4O3/c1-18-29(19(2)42-37-18)20-4-7-27-26(15-20)36-30(39(27)32-8-11-33(41-3,12-9-32)13-10-32)28-16-21-14-23(21)31(40)38(28)22-5-6-24(34)25(35)17-22/h4-7,15,17,21,23,28H,8-14,16H2,1-3H3/t21-,23-,28+,32?,33?/m1/s1 |
| InChIKey | MSDYJZMQGKWYMG-LSGSESPISA-N |
| XLogP | 7.15 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |