C10H18F3NO — CID 171414260
(6R)-1,2,2,6-tetramethyl-4-(trifluoromethoxy)piperidine (PubChem CID 171414260) has the molecular formula C10H18F3NO and a molecular weight of 225.25 g/mol. Its IUPAC name is (6R)-1,2,2,6-tetramethyl-4-(trifluoromethoxy)piperidine.
| Compound Name | (6R)-1,2,2,6-tetramethyl-4-(trifluoromethoxy)piperidine |
|---|---|
| PubChem CID | 171414260 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (6R)-1,2,2,6-tetramethyl-4-(trifluoromethoxy)piperidine |
| SMILES | C[C@@H]1CC(OC(F)(F)F)CC(C)(C)N1C |
| InChI | InChI=1S/C10H18F3NO/c1-7-5-8(15-10(11,12)13)6-9(2,3)14(7)4/h7-8H,5-6H2,1-4H3/t7-,8?/m1/s1 |
| InChIKey | AKZVTEUEUOEZOB-GVHYBUMESA-N |
| XLogP | 2.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |