C25H27FN6S2 — CID 171415060
4-[[5-[(4-butylphenyl)diazenyl]-6-fluorothieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline (PubChem CID 171415060) has the molecular formula C25H27FN6S2 and a molecular weight of 494.67 g/mol. Its IUPAC name is 4-[[5-[(4-butylphenyl)diazenyl]-6-fluorothieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline.
| Compound Name | 4-[[5-[(4-butylphenyl)diazenyl]-6-fluorothieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 171415060 |
| Molecular Formula | C25H27FN6S2 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 4-[[5-[(4-butylphenyl)diazenyl]-6-fluorothieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline |
| SMILES | CCCCc1ccc(/N=N/c2sc3nc(/N=N/c4ccc(N(CC)CC)cc4)sc3c2F)cc1 |
| InChI | InChI=1S/C25H27FN6S2/c1-4-7-8-17-9-11-18(12-10-17)28-30-23-21(26)22-24(34-23)27-25(33-22)31-29-19-13-15-20(16-14-19)32(5-2)6-3/h9-16H,4-8H2,1-3H3/b30-28+,31-29+ |
| InChIKey | OQSBPRFPMPUCBK-FUEWEDNTSA-N |
| XLogP | 9.52 |
| TPSA | 65.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|