About (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine
(2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine (PubChem CID 171415525) has the molecular formula C11H21F2NO
and a molecular weight of 221.29 g/mol. Its IUPAC name is (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine.
Molecular Properties
| Compound Name | (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine |
| PubChem CID | 171415525 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine |
| SMILES | CN1CCC[C@H]1[C@@H](OC(C)(C)C)C(F)F |
| InChI | InChI=1S/C11H21F2NO/c1-11(2,3)15-9(10(12)13)8-6-5-7-14(8)4/h8-10H,5-7H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | ZXVGOVMYWLYGOX-DTWKUNHWSA-N |
| XLogP | 2.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine?
The IUPAC name of (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine (CID 171415525) is (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine.
What is the SMILES notation for (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine?
The canonical SMILES for (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine is CN1CCC[C@H]1[C@@H](OC(C)(C)C)C(F)F.
What is the InChIKey of (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine?
The InChIKey is ZXVGOVMYWLYGOX-DTWKUNHWSA-N. The full InChI is InChI=1S/C11H21F2NO/c1-11(2,3)15-9(10(12)13)8-6-5-7-14(8)4/h8-10H,5-7H2,1-4H3/t8-,9+/m0/s1.
What are the key properties of (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine?
(2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine has a molecular weight of 221.29 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(1R)-2,2-difluoro-1-[(2-methylpropan-2-yl)oxy]ethyl]-1-methylpyrrolidine is sourced from PubChem (CID 171415525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).