C60H58N3+ — CID 171416399
N-[4-[4-tert-butyl-1-[4-(N-phenylanilino)phenyl]cyclohexyl]phenyl]-N-(9,9-dimethylfluoren-2-yl)-1-phenylpyridin-1-ium-4-amine (PubChem CID 171416399) has the molecular formula C60H58N3+ and a molecular weight of 821.15 g/mol. Its IUPAC name is N-[4-[4-tert-butyl-1-[4-(N-phenylanilino)phenyl]cyclohexyl]phenyl]-N-(9,9-dimethylfluoren-2-yl)-1-phenylpyridin-1-ium-4-amine.
| Compound Name | N-[4-[4-tert-butyl-1-[4-(N-phenylanilino)phenyl]cyclohexyl]phenyl]-N-(9,9-dimethylfluoren-2-yl)-1-phenylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 171416399 |
| Molecular Formula | C60H58N3+ |
| Molecular Weight | 821.15 g/mol |
| Exact Mass | 820.46 |
| IUPAC Name | N-[4-[4-tert-butyl-1-[4-(N-phenylanilino)phenyl]cyclohexyl]phenyl]-N-(9,9-dimethylfluoren-2-yl)-1-phenylpyridin-1-ium-4-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(C4(c5ccc(N(c6ccccc6)c6ccccc6)cc5)CCC(C(C)(C)C)CC4)cc3)c3cc[n+](-c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C60H58N3/c1-58(2,3)44-35-39-60(40-36-44,45-25-29-50(30-26-45)62(48-19-11-7-12-20-48)49-21-13-8-14-22-49)46-27-31-51(32-28-46)63(52-37-41-61(42-38-52)47-17-9-6-10-18-47)53-33-34-55-54-23-15-16-24-56(54)59(4,5)57(55)43-53/h6-34,37-38,41-44H,35-36,39-40H2,1-5H3/q+1 |
| InChIKey | PYIRBRRJJXGBCS-UHFFFAOYSA-N |
| XLogP | 15.73 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.15 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|