About 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine
6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine (PubChem CID 171417570) has the molecular formula C11H7BrFNO
and a molecular weight of 268.08 g/mol. Its IUPAC name is 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine.
Molecular Properties
| Compound Name | 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine |
| PubChem CID | 171417570 |
| Molecular Formula | C11H7BrFNO |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine |
| SMILES | [C-]#[N+]c1c(F)cc(Br)c2c1OCC=CC2 |
| InChI | InChI=1S/C11H7BrFNO/c1-14-10-9(13)6-8(12)7-4-2-3-5-15-11(7)10/h2-3,6H,4-5H2 |
| InChIKey | FBKKOAPXFRTQGX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine?
The IUPAC name of 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine (CID 171417570) is 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine.
What is the SMILES notation for 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine?
The canonical SMILES for 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine is [C-]#[N+]c1c(F)cc(Br)c2c1OCC=CC2.
What is the InChIKey of 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine?
The InChIKey is FBKKOAPXFRTQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrFNO/c1-14-10-9(13)6-8(12)7-4-2-3-5-15-11(7)10/h2-3,6H,4-5H2.
What are the key properties of 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine?
6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine has a molecular weight of 268.08 g/mol, XLogP of 3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-fluoro-9-isocyano-2,5-dihydro-1-benzoxepine is sourced from PubChem (CID 171417570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).