C12H8FNO3 — CID 171417597
5-fluoro-4-isocyano-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-7-carboxylic acid (PubChem CID 171417597) has the molecular formula C12H8FNO3 and a molecular weight of 233.20 g/mol. Its IUPAC name is 5-fluoro-4-isocyano-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-7-carboxylic acid.
| Compound Name | 5-fluoro-4-isocyano-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-7-carboxylic acid |
|---|---|
| PubChem CID | 171417597 |
| Molecular Formula | C12H8FNO3 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 5-fluoro-4-isocyano-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-7-carboxylic acid |
| SMILES | [C-]#[N+]c1c(F)cc(C(=O)O)c2c1OCC1CC21 |
| InChI | InChI=1S/C12H8FNO3/c1-14-10-8(13)3-7(12(15)16)9-6-2-5(6)4-17-11(9)10/h3,5-6H,2,4H2,(H,15,16) |
| InChIKey | BOIMKFSNPNKLBJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|