C8H12F6O3 — CID 171417876
2-(1,1-difluoro-2-methylpropoxy)-2,3,3,3-tetrafluoro-1-methoxypropan-1-ol (PubChem CID 171417876) has the molecular formula C8H12F6O3 and a molecular weight of 270.17 g/mol. Its IUPAC name is 2-(1,1-difluoro-2-methylpropoxy)-2,3,3,3-tetrafluoro-1-methoxypropan-1-ol.
| Compound Name | 2-(1,1-difluoro-2-methylpropoxy)-2,3,3,3-tetrafluoro-1-methoxypropan-1-ol |
|---|---|
| PubChem CID | 171417876 |
| Molecular Formula | C8H12F6O3 |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(1,1-difluoro-2-methylpropoxy)-2,3,3,3-tetrafluoro-1-methoxypropan-1-ol |
| SMILES | COC(O)C(F)(OC(F)(F)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H12F6O3/c1-4(2)7(10,11)17-6(9,5(15)16-3)8(12,13)14/h4-5,15H,1-3H3 |
| InChIKey | CBELZWGJABQUTR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|