C35H31F4N3O14S2 — CID 171418189
3',6'-diamino-3-oxo-2-[2-[2-[2-[3-oxo-3-(2,3,5,6-tetrafluorophenoxy)propoxy]ethoxy]ethoxy]ethoxy]spiro[isoindole-1,9'-xanthene]-4',5'-disulfonic acid (PubChem CID 171418189) has the molecular formula C35H31F4N3O14S2 and a molecular weight of 857.77 g/mol. Its IUPAC name is 3',6'-diamino-3-oxo-2-[2-[2-[2-[3-oxo-3-(2,3,5,6-tetrafluorophenoxy)propoxy]ethoxy]ethoxy]ethoxy]spiro[isoindole-1,9'-xanthene]-4',5'-disulfonic acid.
| Compound Name | 3',6'-diamino-3-oxo-2-[2-[2-[2-[3-oxo-3-(2,3,5,6-tetrafluorophenoxy)propoxy]ethoxy]ethoxy]ethoxy]spiro[isoindole-1,9'-xanthene]-4',5'-disulfonic acid |
|---|---|
| PubChem CID | 171418189 |
| Molecular Formula | C35H31F4N3O14S2 |
| Molecular Weight | 857.77 g/mol |
| Exact Mass | 857.12 |
| IUPAC Name | 3',6'-diamino-3-oxo-2-[2-[2-[2-[3-oxo-3-(2,3,5,6-tetrafluorophenoxy)propoxy]ethoxy]ethoxy]ethoxy]spiro[isoindole-1,9'-xanthene]-4',5'-disulfonic acid |
| SMILES | Nc1ccc2c(c1S(=O)(=O)O)Oc1c(ccc(N)c1S(=O)(=O)O)C21c2ccccc2C(=O)N1OCCOCCOCCOCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C35H31F4N3O14S2/c36-22-17-23(37)28(39)31(27(22)38)55-26(43)9-10-51-11-12-52-13-14-53-15-16-54-42-34(44)18-3-1-2-4-19(18)35(42)20-5-7-24(40)32(57(45,46)47)29(20)56-30-21(35)6-8-25(41)33(30)58(48,49)50/h1-8,17H,9-16,40-41H2,(H,45,46,47)(H,48,49,50) |
| InChIKey | QGPFZCRFGLCBMA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 253.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|