C22H27NO4 — CID 17141875
2-(3-methylphenoxy)-N-[3-(oxolan-2-ylmethoxy)phenyl]butanamide (PubChem CID 17141875) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-N-[3-(oxolan-2-ylmethoxy)phenyl]butanamide.
| Compound Name | 2-(3-methylphenoxy)-N-[3-(oxolan-2-ylmethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 17141875 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-(3-methylphenoxy)-N-[3-(oxolan-2-ylmethoxy)phenyl]butanamide |
| SMILES | CCC(Oc1cccc(C)c1)C(=O)Nc1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C22H27NO4/c1-3-21(27-19-10-4-7-16(2)13-19)22(24)23-17-8-5-9-18(14-17)26-15-20-11-6-12-25-20/h4-5,7-10,13-14,20-21H,3,6,11-12,15H2,1-2H3,(H,23,24) |
| InChIKey | SHGNSZHKMFJJOK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |