C24H30BrNO4 — CID 17141909
3-bromo-4-hexoxy-N-[3-(oxolan-2-ylmethoxy)phenyl]benzamide (PubChem CID 17141909) has the molecular formula C24H30BrNO4 and a molecular weight of 476.41 g/mol. Its IUPAC name is 3-bromo-4-hexoxy-N-[3-(oxolan-2-ylmethoxy)phenyl]benzamide.
| Compound Name | 3-bromo-4-hexoxy-N-[3-(oxolan-2-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17141909 |
| Molecular Formula | C24H30BrNO4 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-bromo-4-hexoxy-N-[3-(oxolan-2-ylmethoxy)phenyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2cccc(OCC3CCCO3)c2)cc1Br |
| InChI | InChI=1S/C24H30BrNO4/c1-2-3-4-5-13-29-23-12-11-18(15-22(23)25)24(27)26-19-8-6-9-20(16-19)30-17-21-10-7-14-28-21/h6,8-9,11-12,15-16,21H,2-5,7,10,13-14,17H2,1H3,(H,26,27) |
| InChIKey | CAFQXTDUMBJZNG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|