C22H23F3N4O4S — CID 171420425
N-[2,4,5-trifluoro-3-[hydroxy-(3-morpholin-4-ylquinoxalin-6-yl)methyl]phenyl]propane-1-sulfonamide (PubChem CID 171420425) has the molecular formula C22H23F3N4O4S and a molecular weight of 496.51 g/mol. Its IUPAC name is N-[2,4,5-trifluoro-3-[hydroxy-(3-morpholin-4-ylquinoxalin-6-yl)methyl]phenyl]propane-1-sulfonamide.
| Compound Name | N-[2,4,5-trifluoro-3-[hydroxy-(3-morpholin-4-ylquinoxalin-6-yl)methyl]phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 171420425 |
| Molecular Formula | C22H23F3N4O4S |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N-[2,4,5-trifluoro-3-[hydroxy-(3-morpholin-4-ylquinoxalin-6-yl)methyl]phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1cc(F)c(F)c(C(O)c2ccc3ncc(N4CCOCC4)nc3c2)c1F |
| InChI | InChI=1S/C22H23F3N4O4S/c1-2-9-34(31,32)28-17-11-14(23)20(24)19(21(17)25)22(30)13-3-4-15-16(10-13)27-18(12-26-15)29-5-7-33-8-6-29/h3-4,10-12,22,28,30H,2,5-9H2,1H3 |
| InChIKey | ZBBRLYKTNDAOFF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|