About 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine
6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine (PubChem CID 171420467) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine.
Analyze 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine?
The IUPAC name of 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine (CID 171420467) is 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine.
What is the SMILES notation for 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine?
The canonical SMILES for 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine is CC(C)C1=NNCNC1.
What is the InChIKey of 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine?
The InChIKey is ZGWLVRAZPOVPID-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-5(2)6-3-7-4-8-9-6/h5,7-8H,3-4H2,1-2H3.
What are the key properties of 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine?
6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine has a molecular weight of 127.19 g/mol, XLogP of 0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-2,3,4,5-tetrahydro-1,2,4-triazine is sourced from PubChem (CID 171420467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).