C36H44O3 — CID 171421190
1,3,4-trimethyl-5-[1-(3-methyl-2-prop-2-enoxyphenyl)-1-(2,3,5-trimethyl-4-prop-2-enoxyphenyl)ethyl]-2-prop-2-enoxybenzene (PubChem CID 171421190) has the molecular formula C36H44O3 and a molecular weight of 524.75 g/mol. Its IUPAC name is 1,3,4-trimethyl-5-[1-(3-methyl-2-prop-2-enoxyphenyl)-1-(2,3,5-trimethyl-4-prop-2-enoxyphenyl)ethyl]-2-prop-2-enoxybenzene.
| Compound Name | 1,3,4-trimethyl-5-[1-(3-methyl-2-prop-2-enoxyphenyl)-1-(2,3,5-trimethyl-4-prop-2-enoxyphenyl)ethyl]-2-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 171421190 |
| Molecular Formula | C36H44O3 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | 1,3,4-trimethyl-5-[1-(3-methyl-2-prop-2-enoxyphenyl)-1-(2,3,5-trimethyl-4-prop-2-enoxyphenyl)ethyl]-2-prop-2-enoxybenzene |
| SMILES | C=CCOc1c(C)cccc1C(C)(c1cc(C)c(OCC=C)c(C)c1C)c1cc(C)c(OCC=C)c(C)c1C |
| InChI | InChI=1S/C36H44O3/c1-12-18-37-33-24(5)21-31(26(7)28(33)9)36(11,30-17-15-16-23(4)35(30)39-20-14-3)32-22-25(6)34(38-19-13-2)29(10)27(32)8/h12-17,21-22H,1-3,18-20H2,4-11H3 |
| InChIKey | SGLMXBHVTBCZCP-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|