C34H40O3 — CID 171421206
1,3,4-trimethyl-2-prop-2-enoxy-5-[(4-prop-2-enoxyphenyl)-(2,3,5-trimethyl-4-prop-2-enoxyphenyl)methyl]benzene (PubChem CID 171421206) has the molecular formula C34H40O3 and a molecular weight of 496.69 g/mol. Its IUPAC name is 1,3,4-trimethyl-2-prop-2-enoxy-5-[(4-prop-2-enoxyphenyl)-(2,3,5-trimethyl-4-prop-2-enoxyphenyl)methyl]benzene.
| Compound Name | 1,3,4-trimethyl-2-prop-2-enoxy-5-[(4-prop-2-enoxyphenyl)-(2,3,5-trimethyl-4-prop-2-enoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 171421206 |
| Molecular Formula | C34H40O3 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 1,3,4-trimethyl-2-prop-2-enoxy-5-[(4-prop-2-enoxyphenyl)-(2,3,5-trimethyl-4-prop-2-enoxyphenyl)methyl]benzene |
| SMILES | C=CCOc1ccc(C(c2cc(C)c(OCC=C)c(C)c2C)c2cc(C)c(OCC=C)c(C)c2C)cc1 |
| InChI | InChI=1S/C34H40O3/c1-10-17-35-29-15-13-28(14-16-29)32(30-20-22(4)33(36-18-11-2)26(8)24(30)6)31-21-23(5)34(37-19-12-3)27(9)25(31)7/h10-16,20-21,32H,1-3,17-19H2,4-9H3 |
| InChIKey | PQDYWGNALHYZSB-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|