C50H32N4 — CID 171421853
4-[3-(21-isocyano-21-methyl-18-pentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaenyl)-5-pyridin-3-ylphenyl]-2,6-diphenylpyrimidine (PubChem CID 171421853) has the molecular formula C50H32N4 and a molecular weight of 688.83 g/mol. Its IUPAC name is 4-[3-(21-isocyano-21-methyl-18-pentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaenyl)-5-pyridin-3-ylphenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[3-(21-isocyano-21-methyl-18-pentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaenyl)-5-pyridin-3-ylphenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 171421853 |
| Molecular Formula | C50H32N4 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | 4-[3-(21-isocyano-21-methyl-18-pentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaenyl)-5-pyridin-3-ylphenyl]-2,6-diphenylpyrimidine |
| SMILES | [C-]#[N+]C1(C)c2cc(-c3cc(-c4cccnc4)cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc2-c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C50H32N4/c1-50(51-2)44-29-34(23-24-43(44)47-41-21-11-9-19-39(41)40-20-10-12-22-42(40)48(47)50)36-26-37(35-18-13-25-52-31-35)28-38(27-36)46-30-45(32-14-5-3-6-15-32)53-49(54-46)33-16-7-4-8-17-33/h3-31H,1H3 |
| InChIKey | WMXAMYUJHFHMOR-UHFFFAOYSA-N |
| XLogP | 12.68 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|