C55H36N6 — CID 171422020
9,9-dimethyl-7-[3-(1,10-phenanthrolin-4-yl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]fluorene-2-carbonitrile (PubChem CID 171422020) has the molecular formula C55H36N6 and a molecular weight of 780.94 g/mol. Its IUPAC name is 9,9-dimethyl-7-[3-(1,10-phenanthrolin-4-yl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]fluorene-2-carbonitrile.
| Compound Name | 9,9-dimethyl-7-[3-(1,10-phenanthrolin-4-yl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]fluorene-2-carbonitrile |
|---|---|
| PubChem CID | 171422020 |
| Molecular Formula | C55H36N6 |
| Molecular Weight | 780.94 g/mol |
| Exact Mass | 780.30 |
| IUPAC Name | 9,9-dimethyl-7-[3-(1,10-phenanthrolin-4-yl)-5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]fluorene-2-carbonitrile |
| SMILES | CC1(C)c2cc(C#N)ccc2-c2ccc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)cc(-c4ccnc5c4ccc4cccnc45)c3)cc21 |
| InChI | InChI=1S/C55H36N6/c1-55(2)48-28-34(33-56)15-22-45(48)46-23-21-40(32-49(46)55)41-29-42(44-25-27-58-51-47(44)24-20-37-14-9-26-57-50(37)51)31-43(30-41)54-60-52(38-12-7-4-8-13-38)59-53(61-54)39-18-16-36(17-19-39)35-10-5-3-6-11-35/h3-32H,1-2H3 |
| InChIKey | VTWFBGLCBSLTRU-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.94 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|