C30H23FN6O2 — CID 171423308
2-fluoro-1-N,4-N-bis[4-(pyridin-4-ylamino)phenyl]benzene-1,4-dicarboxamide (PubChem CID 171423308) has the molecular formula C30H23FN6O2 and a molecular weight of 518.55 g/mol. Its IUPAC name is 2-fluoro-1-N,4-N-bis[4-(pyridin-4-ylamino)phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 2-fluoro-1-N,4-N-bis[4-(pyridin-4-ylamino)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 171423308 |
| Molecular Formula | C30H23FN6O2 |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 2-fluoro-1-N,4-N-bis[4-(pyridin-4-ylamino)phenyl]benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccncc2)cc1)c1ccc(C(=O)Nc2ccc(Nc3ccncc3)cc2)c(F)c1 |
| InChI | InChI=1S/C30H23FN6O2/c31-28-19-20(29(38)36-23-6-2-21(3-7-23)34-25-11-15-32-16-12-25)1-10-27(28)30(39)37-24-8-4-22(5-9-24)35-26-13-17-33-18-14-26/h1-19H,(H,32,34)(H,33,35)(H,36,38)(H,37,39) |
| InChIKey | KYUOONBYVNUYFN-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |