C32H29FN6O2+2 — CID 171423311
2-fluoro-1-N,4-N-bis[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]benzene-1,4-dicarboxamide (PubChem CID 171423311) has the molecular formula C32H29FN6O2+2 and a molecular weight of 548.62 g/mol. Its IUPAC name is 2-fluoro-1-N,4-N-bis[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 2-fluoro-1-N,4-N-bis[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 171423311 |
| Molecular Formula | C32H29FN6O2+2 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 2-fluoro-1-N,4-N-bis[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]benzene-1,4-dicarboxamide |
| SMILES | C[n+]1ccc(Nc2ccc(NC(=O)c3ccc(C(=O)Nc4ccc(Nc5cc[n+](C)cc5)cc4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C32H27FN6O2/c1-38-17-13-27(14-18-38)34-23-4-8-25(9-5-23)36-31(40)22-3-12-29(30(33)21-22)32(41)37-26-10-6-24(7-11-26)35-28-15-19-39(2)20-16-28/h3-21H,1-2H3,(H2,36,37,40,41)/p+2 |
| InChIKey | RKZCRVDXHUKVID-UHFFFAOYSA-P |
| XLogP | 5.47 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|