About 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide
4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide (PubChem CID 171423386) has the molecular formula C24H18FN5O2
and a molecular weight of 427.44 g/mol. Its IUPAC name is 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide |
| PubChem CID | 171423386 |
| Molecular Formula | C24H18FN5O2 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccncc1)c1ccc(C(=O)Nc2ccc(Nc3ccncc3)c(F)c2)cc1 |
| InChI | InChI=1S/C24H18FN5O2/c25-21-15-20(5-6-22(21)28-18-7-11-26-12-8-18)30-24(32)17-3-1-16(2-4-17)23(31)29-19-9-13-27-14-10-19/h1-15H,(H,26,28)(H,30,32)(H,27,29,31) |
| InChIKey | XGMGMGZFJYHCAE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide?
The IUPAC name of 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide (CID 171423386) is 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide.
What is the SMILES notation for 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide?
The canonical SMILES for 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide is O=C(Nc1ccncc1)c1ccc(C(=O)Nc2ccc(Nc3ccncc3)c(F)c2)cc1.
What is the InChIKey of 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide?
The InChIKey is XGMGMGZFJYHCAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18FN5O2/c25-21-15-20(5-6-22(21)28-18-7-11-26-12-8-18)30-24(32)17-3-1-16(2-4-17)23(31)29-19-9-13-27-14-10-19/h1-15H,(H,26,28)(H,30,32)(H,27,29,31).
What are the key properties of 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide?
4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide has a molecular weight of 427.44 g/mol, XLogP of 4.86, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[3-fluoro-4-(pyridin-4-ylamino)phenyl]-1-N-pyridin-4-ylbenzene-1,4-dicarboxamide is sourced from PubChem (CID 171423386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).