C42H43Cl2NOP+ — CID 171423617
[7-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-7-oxoheptyl]-triphenylphosphanium (PubChem CID 171423617) has the molecular formula C42H43Cl2NOP+ and a molecular weight of 679.69 g/mol. Its IUPAC name is [7-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-7-oxoheptyl]-triphenylphosphanium.
| Compound Name | [7-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-7-oxoheptyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 171423617 |
| Molecular Formula | C42H43Cl2NOP+ |
| Molecular Weight | 679.69 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | [7-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]-7-oxoheptyl]-triphenylphosphanium |
| SMILES | CN(C(=O)CCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C42H43Cl2NOP/c1-45(41-29-27-36(37-23-14-15-24-38(37)41)32-26-28-39(43)40(44)31-32)42(46)25-13-2-3-16-30-47(33-17-7-4-8-18-33,34-19-9-5-10-20-34)35-21-11-6-12-22-35/h4-12,14-15,17-24,26,28,31,36,41H,2-3,13,16,25,27,29-30H2,1H3/q+1/t36-,41-/m0/s1 |
| InChIKey | HUFOAYDNLMIFRS-ASVWIKLXSA-N |
| XLogP | 10.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.69 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|