About carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+)
carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+) (PubChem CID 171424335) has the molecular formula C5H11OY2
and a molecular weight of 264.95 g/mol. Its IUPAC name is carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+).
Molecular Properties
| Compound Name | carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+) |
| PubChem CID | 171424335 |
| Molecular Formula | C5H11OY2 |
| Molecular Weight | 264.95 g/mol |
| Exact Mass | 264.89 |
| IUPAC Name | carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+) |
| SMILES | [CH2-]O[C@H]([CH2-])C.[CH3-].[Y+3].[Y] |
| InChI | InChI=1S/C4H8O.CH3.2Y/c1-4(2)5-3;;;/h4H,1,3H2,2H3;1H3;;/q-2;-1;;+3/t4-;;;/m1.../s1 |
| InChIKey | GKRMBSRJULLOCJ-VYOFIOMFSA-N |
| XLogP | 1.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.95 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+)?
The IUPAC name of carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+) (CID 171424335) is carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+).
What is the SMILES notation for carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+)?
The canonical SMILES for carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+) is [CH2-]O[C@H]([CH2-])C.[CH3-].[Y+3].[Y].
What is the InChIKey of carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+)?
The InChIKey is GKRMBSRJULLOCJ-VYOFIOMFSA-N. The full InChI is InChI=1S/C4H8O.CH3.2Y/c1-4(2)5-3;;;/h4H,1,3H2,2H3;1H3;;/q-2;-1;;+3/t4-;;;/m1.../s1.
What are the key properties of carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+)?
carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+) has a molecular weight of 264.95 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(2R)-2-methanidyloxypropane;yttrium;yttrium(3+) is sourced from PubChem (CID 171424335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).