About (2S,5S)-2,5-dimethyl-1,4-oxazepane
(2S,5S)-2,5-dimethyl-1,4-oxazepane (PubChem CID 171424392) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is (2S,5S)-2,5-dimethyl-1,4-oxazepane.
Molecular Properties
| Compound Name | (2S,5S)-2,5-dimethyl-1,4-oxazepane |
| PubChem CID | 171424392 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (2S,5S)-2,5-dimethyl-1,4-oxazepane |
| SMILES | C[C@H]1CCO[C@@H](C)CN1 |
| InChI | InChI=1S/C7H15NO/c1-6-3-4-9-7(2)5-8-6/h6-8H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | DAPGSXNRQPHDAL-BQBZGAKWSA-N |
| XLogP | 0.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,5S)-2,5-dimethyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-2,5-dimethyl-1,4-oxazepane?
The IUPAC name of (2S,5S)-2,5-dimethyl-1,4-oxazepane (CID 171424392) is (2S,5S)-2,5-dimethyl-1,4-oxazepane.
What is the SMILES notation for (2S,5S)-2,5-dimethyl-1,4-oxazepane?
The canonical SMILES for (2S,5S)-2,5-dimethyl-1,4-oxazepane is C[C@H]1CCO[C@@H](C)CN1.
What is the InChIKey of (2S,5S)-2,5-dimethyl-1,4-oxazepane?
The InChIKey is DAPGSXNRQPHDAL-BQBZGAKWSA-N. The full InChI is InChI=1S/C7H15NO/c1-6-3-4-9-7(2)5-8-6/h6-8H,3-5H2,1-2H3/t6-,7-/m0/s1.
What are the key properties of (2S,5S)-2,5-dimethyl-1,4-oxazepane?
(2S,5S)-2,5-dimethyl-1,4-oxazepane has a molecular weight of 129.20 g/mol, XLogP of 0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-2,5-dimethyl-1,4-oxazepane is sourced from PubChem (CID 171424392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).