C9H12BN3O2 — CID 171424752
4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylpyrazole-3-carbonitrile (PubChem CID 171424752) has the molecular formula C9H12BN3O2 and a molecular weight of 205.03 g/mol. Its IUPAC name is 4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylpyrazole-3-carbonitrile.
| Compound Name | 4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylpyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 171424752 |
| Molecular Formula | C9H12BN3O2 |
| Molecular Weight | 205.03 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylpyrazole-3-carbonitrile |
| SMILES | Cn1cc(B2OCC(C)(C)O2)c(C#N)n1 |
| InChI | InChI=1S/C9H12BN3O2/c1-9(2)6-14-10(15-9)7-5-13(3)12-8(7)4-11/h5H,6H2,1-3H3 |
| InChIKey | LOHVXKSSEDPSHY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.03 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|